CAS 2129597-34-6 appears in our catalog under these names: Lifitegrast Impurity 5, Lifitegrast Impurity 19, Lifitegrast Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1-benzofuran-6-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carboxylic acid (CAS 2129597-34-6) is a chemical compound with the molecular formula C19H13Cl2NO4 and a molecular weight of 390.2 g/mol. IUPAC name: 2-(1-benzofuran-6-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carboxylic acid. InChIKey: JBZCAVOWDLZTLZ-UHFFFAOYSA-N.
| Molecular formula | C19H13Cl2NO4 |
|---|---|
| Molecular weight | 390.2 g/mol |
| IUPAC name | 2-(1-benzofuran-6-carbonyl)-5,7-dichloro-3,4-dihydro-1H-isoquinoline-6-carboxylic acid |
| InChIKey | JBZCAVOWDLZTLZ-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC(=C(C(=C21)Cl)C(=O)O)Cl)C(=O)C3=CC4=C(C=C3)C=CO4 |
Computed by PubChem (NCBI)