CAS 2131783-01-0 is the registry number for 6-Bromo-2-methoxy-3-((2,3,6-trimethoxypyridin-4-yl)methyl)quinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-bromo-2-methoxy-3-[(2,3,6-trimethoxy-4-pyridinyl)methyl]quinoline (CAS 2131783-01-0) is a chemical compound with the molecular formula C19H19BrN2O4 and a molecular weight of 419.3 g/mol. IUPAC name: 6-bromo-2-methoxy-3-[(2,3,6-trimethoxy-4-pyridinyl)methyl]quinoline. InChIKey: PAFWZDDYLDEHJJ-UHFFFAOYSA-N.
| Molecular formula | C19H19BrN2O4 |
|---|---|
| Molecular weight | 419.3 g/mol |
| IUPAC name | 6-bromo-2-methoxy-3-[(2,3,6-trimethoxy-4-pyridinyl)methyl]quinoline |
| InChIKey | PAFWZDDYLDEHJJ-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C(=C1)CC2=C(N=C3C=CC(=CC3=C2)Br)OC)OC)OC |
Computed by PubChem (NCBI)