CAS 2131799-40-9 is the registry number for Tert-butyl((4,5-dimethylhexa-2,3-dien-1-yl)oxy)dimethylsilane, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl-(4,5-dimethylhexa-2,3-dienoxy)-dimethylsilane (CAS 2131799-40-9) is a chemical compound with the molecular formula C14H28OSi and a molecular weight of 240.46 g/mol. IUPAC name: tert-butyl-(4,5-dimethylhexa-2,3-dienoxy)-dimethylsilane. InChIKey: BDJWDWJHWKBSLM-UHFFFAOYSA-N.
| Molecular formula | C14H28OSi |
|---|---|
| Molecular weight | 240.46 g/mol |
| IUPAC name | tert-butyl-(4,5-dimethylhexa-2,3-dienoxy)-dimethylsilane |
| InChIKey | BDJWDWJHWKBSLM-UHFFFAOYSA-N |
| SMILES | CC(C)C(=C=CCO[Si](C)(C)C(C)(C)C)C |
Computed by PubChem (NCBI)