Products 2133456-02-5
CAS 2133456-02-5 is the registry number for Eicosapentaenoyl-L-carnitine (chloride), 93.4%. Offered by: MedChemExpress. Available pack sizes: 5 mg (51.86 mM * 200 μL in Ethanol), 25 mg (51.86 mM * 1 mL in Ethanol), 10 mg (51.86 mM * 400 μL in Ethanol).
[(2R)-3-carboxy-2-[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]oxypropyl]-trimethylazanium chloride (CAS 2133456-02-5) is a chemical compound with the molecular formula C27H44ClNO4 and a molecular weight of 482.1 g/mol. IUPAC name: [(2R)-3-carboxy-2-[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]oxypropyl]-trimethylazanium chloride. InChIKey: PATZUBDUDJXSNV-FSYJDYLDSA-N.
| Molecular formula | C27H44ClNO4 |
|---|---|
| Molecular weight | 482.1 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-[(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoyl]oxypropyl]-trimethylazanium chloride |
| InChIKey | PATZUBDUDJXSNV-FSYJDYLDSA-N |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)