Products 2135820-16-3
CAS 2135820-16-3 is the registry number for N-([1,1'-biphenyl]-2-yl)triphenylen-2-amine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(2-phenylphenyl)triphenylen-2-amine (CAS 2135820-16-3) is a chemical compound with the molecular formula C30H21N and a molecular weight of 395.5 g/mol. IUPAC name: N-(2-phenylphenyl)triphenylen-2-amine. InChIKey: XQHXQQPLPQGXGE-UHFFFAOYSA-N.
| Molecular formula | C30H21N |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | N-(2-phenylphenyl)triphenylen-2-amine |
| InChIKey | XQHXQQPLPQGXGE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2NC3=CC4=C(C=C3)C5=CC=CC=C5C6=CC=CC=C64 |
Computed by PubChem (NCBI)