CAS 213741-30-1 is the registry number for 2-tert-Butoxycarbonylamino-3-(4-trifluoromethyl-phenyl)-acrylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (CAS 213741-30-1) is a chemical compound with the molecular formula C16H18F3NO4 and a molecular weight of 345.31 g/mol. IUPAC name: methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethyl)phenyl]prop-2-enoate. InChIKey: UULXKCCBPCVSCR-UHFFFAOYSA-N.
| Molecular formula | C16H18F3NO4 |
|---|---|
| Molecular weight | 345.31 g/mol |
| IUPAC name | methyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| InChIKey | UULXKCCBPCVSCR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(=CC1=CC=C(C=C1)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)