Products 2148445-66-1
CAS 2148445-66-1 is the registry number for tert-butyl N-(4-bromo-5-chloro-2-fluorophenyl)carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl N-(4-bromo-5-chloro-2-fluorophenyl)carbamate (CAS 2148445-66-1) is a chemical compound with the molecular formula C11H12BrClFNO2 and a molecular weight of 324.57 g/mol. IUPAC name: tert-butyl N-(4-bromo-5-chloro-2-fluorophenyl)carbamate. InChIKey: JWIRJXHBRBYYQK-UHFFFAOYSA-N.
| Molecular formula | C11H12BrClFNO2 |
|---|---|
| Molecular weight | 324.57 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-5-chloro-2-fluorophenyl)carbamate |
| InChIKey | JWIRJXHBRBYYQK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1F)Br)Cl |
Computed by PubChem (NCBI)