CAS 2165991-49-9 is the registry number for tert-Butyl N-[(3R)-4,4-difluoropyrrolidin-3-yl]carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
Tert-butyl N-[(3R)-4,4-difluoropyrrolidin-3-yl]carbamate (CAS 2165991-49-9) is a chemical compound with the molecular formula C9H16F2N2O2 and a molecular weight of 222.23 g/mol. IUPAC name: tert-butyl N-[(3R)-4,4-difluoropyrrolidin-3-yl]carbamate. InChIKey: AYPWPGOPAZUJDF-ZCFIWIBFSA-N.
| Molecular formula | C9H16F2N2O2 |
|---|---|
| Molecular weight | 222.23 g/mol |
| IUPAC name | tert-butyl N-[(3R)-4,4-difluoropyrrolidin-3-yl]carbamate |
| InChIKey | AYPWPGOPAZUJDF-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNCC1(F)F |
Computed by PubChem (NCBI)