Products 2166455-20-3
CAS 2166455-20-3 is the registry number for 3p-C-NOTA. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-6-(4-nitrophenyl)hexanoic acid (CAS 2166455-20-3) is a chemical compound with the molecular formula C22H32N4O8 and a molecular weight of 480.5 g/mol. IUPAC name: 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-6-(4-nitrophenyl)hexanoic acid. InChIKey: MANCOQIZMUKPQJ-UHFFFAOYSA-N.
| Molecular formula | C22H32N4O8 |
|---|---|
| Molecular weight | 480.5 g/mol |
| IUPAC name | 2-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]-6-(4-nitrophenyl)hexanoic acid |
| InChIKey | MANCOQIZMUKPQJ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN(CCN1CC(=O)O)C(CCCCC2=CC=C(C=C2)[N+](=O)[O-])C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)