Products 217075-24-6
CAS 217075-24-6 appears in our catalog under these names: BODIPY FL C5, BODIPY FL C5, 99.68%, BODIPY FL C5, 98%, 5-(5,5-Difluoro-7,9-dimethyl-5H-5l4,6l4-dipyrrolo[1,2-c:2',1'-f][1,3,2]diazaborinin-3-yl)pentanoic acid, 98%, BODIPY FL C5, 99%. Offered by: GLPBio, MedChemExpress, Fluorochem, BLDpharm, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 5 mg, 10 mg, 25mg, 50mg.
5-(2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)pentanoic acid (CAS 217075-24-6) is a chemical compound with the molecular formula C16H19BF2N2O2 and a molecular weight of 320.1 g/mol. IUPAC name: 5-(2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)pentanoic acid. InChIKey: WEBUSSRBUDICAJ-UHFFFAOYSA-N.
| Molecular formula | C16H19BF2N2O2 |
|---|---|
| Molecular weight | 320.1 g/mol |
| IUPAC name | 5-(2,2-difluoro-10,12-dimethyl-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl)pentanoic acid |
| InChIKey | WEBUSSRBUDICAJ-UHFFFAOYSA-N |
| SMILES | [B-]1(N2C(=CC(=C2C=C3[N+]1=C(C=C3)CCCCC(=O)O)C)C)(F)F |
Computed by PubChem (NCBI)