CAS 2177257-82-6 is the registry number for Racemic-(3s,4s)-1-tert-butyl 3-ethyl 4-(1-methyl-1h-imidazol-4-yl)pyrrolidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1-O-tert-butyl 3-O-ethyl (3S,4R)-4-(1-methylimidazol-4-yl)pyrrolidine-1,3-dicarboxylate (CAS 2177257-82-6) is a chemical compound with the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl (3S,4R)-4-(1-methylimidazol-4-yl)pyrrolidine-1,3-dicarboxylate. InChIKey: NSXSCMZZCNHHDT-NWDGAFQWSA-N.
| Molecular formula | C16H25N3O4 |
|---|---|
| Molecular weight | 323.39 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl (3S,4R)-4-(1-methylimidazol-4-yl)pyrrolidine-1,3-dicarboxylate |
| InChIKey | NSXSCMZZCNHHDT-NWDGAFQWSA-N |
| SMILES | CCOC(=O)[C@@H]1CN(C[C@@H]1C2=CN(C=N2)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)