CAS 2197062-04-5 appears in our catalog under these names: 3,3,3-Trifluoro-2-(4-fluoro-1h-indol-3-yl)propanoic acid, 95%, 3,3,3-Trifluoro-2-(4-fluoro-1H-indol-3-yl)propanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
3,3,3-trifluoro-2-(4-fluoro-1H-indol-3-yl)propanoic acid (CAS 2197062-04-5) is a chemical compound with the molecular formula C11H7F4NO2 and a molecular weight of 261.17 g/mol. IUPAC name: 3,3,3-trifluoro-2-(4-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: HUXJTBCPXISCFM-UHFFFAOYSA-N.
| Molecular formula | C11H7F4NO2 |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-(4-fluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | HUXJTBCPXISCFM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)C(=CN2)C(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)