CAS 2197971-41-6 is the registry number for 4-([2,2':6',2''-Terpyridin]-4'-yl)quinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,6-dipyridin-2-yl-4-pyridinyl)quinoline (CAS 2197971-41-6) is a chemical compound with the molecular formula C24H16N4 and a molecular weight of 360.4 g/mol. IUPAC name: 4-(2,6-dipyridin-2-yl-4-pyridinyl)quinoline. InChIKey: QGOKDXHGBWDYPO-UHFFFAOYSA-N.
| Molecular formula | C24H16N4 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 4-(2,6-dipyridin-2-yl-4-pyridinyl)quinoline |
| InChIKey | QGOKDXHGBWDYPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)C3=CC(=NC(=C3)C4=CC=CC=N4)C5=CC=CC=N5 |
Computed by PubChem (NCBI)