CAS 2198380-46-8 is the registry number for (2R)-2-(8-AMINO-1-BROMOIMIDAZO[1,5-A]PY&. Offered by: Sigma-Aldrich. Available pack sizes: 25MG.
Benzyl (2R)-2-(8-amino-1-bromoimidazo[1,5-a]pyrazin-3-yl)pyrrolidine-1-carboxylate (CAS 2198380-46-8) is a chemical compound with the molecular formula C18H18BrN5O2 and a molecular weight of 416.3 g/mol. IUPAC name: benzyl (2R)-2-(8-amino-1-bromoimidazo[1,5-a]pyrazin-3-yl)pyrrolidine-1-carboxylate. InChIKey: DLXYYJDQLZHBNU-CYBMUJFWSA-N.
| Molecular formula | C18H18BrN5O2 |
|---|---|
| Molecular weight | 416.3 g/mol |
| IUPAC name | benzyl (2R)-2-(8-amino-1-bromoimidazo[1,5-a]pyrazin-3-yl)pyrrolidine-1-carboxylate |
| InChIKey | DLXYYJDQLZHBNU-CYBMUJFWSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)C3=NC(=C4N3C=CN=C4N)Br |
Computed by PubChem (NCBI)