CAS 220160-97-4 is the registry number for (2R,2'R,5R,5'R)-1,1'-(9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(2,5-dimethylphospholane), 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-bis[(2R,5R)-2,5-dimethylphospholan-1-yl]-9,9-dimethylxanthene (CAS 220160-97-4) is a chemical compound with the molecular formula C27H36OP2 and a molecular weight of 438.5 g/mol. IUPAC name: 4,5-bis[(2R,5R)-2,5-dimethylphospholan-1-yl]-9,9-dimethylxanthene. InChIKey: HFLAILSQSPIJMB-UAFMIMERSA-N.
| Molecular formula | C27H36OP2 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | 4,5-bis[(2R,5R)-2,5-dimethylphospholan-1-yl]-9,9-dimethylxanthene |
| InChIKey | HFLAILSQSPIJMB-UAFMIMERSA-N |
| SMILES | C[C@@H]1CC[C@H](P1C2=CC=CC3=C2OC4=C(C3(C)C)C=CC=C4P5[C@@H](CC[C@H]5C)C)C |
Computed by PubChem (NCBI)