CAS 220448-02-2 is the registry number for SSR180575. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(7-chloro-5-methyl-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)-N,N-dimethylacetamide (CAS 220448-02-2) is a chemical compound with the molecular formula C21H19ClN4O2 and a molecular weight of 394.9 g/mol. IUPAC name: 2-(7-chloro-5-methyl-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)-N,N-dimethylacetamide. InChIKey: HJSQVJOROCIILI-UHFFFAOYSA-N.
| Molecular formula | C21H19ClN4O2 |
|---|---|
| Molecular weight | 394.9 g/mol |
| IUPAC name | 2-(7-chloro-5-methyl-4-oxo-3-phenylpyridazino[4,5-b]indol-1-yl)-N,N-dimethylacetamide |
| InChIKey | HJSQVJOROCIILI-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Cl)C3=C1C(=O)N(N=C3CC(=O)N(C)C)C4=CC=CC=C4 |
Computed by PubChem (NCBI)