Products 2212005-43-9
CAS 2212005-43-9 is the registry number for 2,6-Bis[(1R)-1-(3,5-dimethylphenyl)ethyl]-4-methylbenzenamine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
2,6-bis[(1R)-1-(3,5-dimethylphenyl)ethyl]-4-methylaniline (CAS 2212005-43-9) is a chemical compound with the molecular formula C27H33N and a molecular weight of 371.6 g/mol. IUPAC name: 2,6-bis[(1R)-1-(3,5-dimethylphenyl)ethyl]-4-methylaniline. InChIKey: RCOCYRJETLTYLL-FGZHOGPDSA-N.
| Molecular formula | C27H33N |
|---|---|
| Molecular weight | 371.6 g/mol |
| IUPAC name | 2,6-bis[(1R)-1-(3,5-dimethylphenyl)ethyl]-4-methylaniline |
| InChIKey | RCOCYRJETLTYLL-FGZHOGPDSA-N |
| SMILES | CC1=CC(=CC(=C1)[C@@H](C)C2=CC(=CC(=C2N)[C@H](C)C3=CC(=CC(=C3)C)C)C)C |
Computed by PubChem (NCBI)