Products 2214257-62-0
CAS 2214257-62-0 is the registry number for 3,3'',5,5''-Tetraisopropyl-[1,1':4',1''-terphenyl]-4,4''-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-[4-amino-3,5-di(propan-2-yl)phenyl]phenyl]-2,6-di(propan-2-yl)aniline (CAS 2214257-62-0) is a chemical compound with the molecular formula C30H40N2 and a molecular weight of 428.7 g/mol. IUPAC name: 4-[4-[4-amino-3,5-di(propan-2-yl)phenyl]phenyl]-2,6-di(propan-2-yl)aniline. InChIKey: LZRMBAMVZDLMNC-UHFFFAOYSA-N.
| Molecular formula | C30H40N2 |
|---|---|
| Molecular weight | 428.7 g/mol |
| IUPAC name | 4-[4-[4-amino-3,5-di(propan-2-yl)phenyl]phenyl]-2,6-di(propan-2-yl)aniline |
| InChIKey | LZRMBAMVZDLMNC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N)C(C)C)C2=CC=C(C=C2)C3=CC(=C(C(=C3)C(C)C)N)C(C)C |
Computed by PubChem (NCBI)