CAS 2223031-03-4 is the registry number for 2–Methyl–5–ethylthiophene–3–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
(5-ethyl-2-methylthiophen-3-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (CAS 2223031-03-4) is a chemical compound with the molecular formula C13H23BO3S and a molecular weight of 270.2 g/mol. IUPAC name: (5-ethyl-2-methylthiophen-3-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid. InChIKey: JQXKXQQIIYILJK-UHFFFAOYSA-N.
| Molecular formula | C13H23BO3S |
|---|---|
| Molecular weight | 270.2 g/mol |
| IUPAC name | (5-ethyl-2-methylthiophen-3-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| InChIKey | JQXKXQQIIYILJK-UHFFFAOYSA-N |
| SMILES | B(C1=C(SC(=C1)CC)C)(O)OC(C)(C)C(C)(C)O |
Computed by PubChem (NCBI)