Products 2223031-78-3
CAS 2223031-78-3 is the registry number for 2–Amino–4–(cyclopropyl)pyrimidine–5–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(2-amino-4-cyclopropylpyrimidin-5-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (CAS 2223031-78-3) is a chemical compound with the molecular formula C13H22BN3O3 and a molecular weight of 279.15 g/mol. IUPAC name: (2-amino-4-cyclopropylpyrimidin-5-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid. InChIKey: YBWGXOQGZXVLPZ-UHFFFAOYSA-N.
| Molecular formula | C13H22BN3O3 |
|---|---|
| Molecular weight | 279.15 g/mol |
| IUPAC name | (2-amino-4-cyclopropylpyrimidin-5-yl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| InChIKey | YBWGXOQGZXVLPZ-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1C2CC2)N)(O)OC(C)(C)C(C)(C)O |
Computed by PubChem (NCBI)