CAS 2223031-99-8 is the registry number for 5–(4–Fluorophenyl)thiazole–4–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[5-(4-fluorophenyl)-1,3-thiazol-4-yl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (CAS 2223031-99-8) is a chemical compound with the molecular formula C15H19BFNO3S and a molecular weight of 323.2 g/mol. IUPAC name: [5-(4-fluorophenyl)-1,3-thiazol-4-yl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid. InChIKey: ATXYSICZQCPPAO-UHFFFAOYSA-N.
| Molecular formula | C15H19BFNO3S |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | [5-(4-fluorophenyl)-1,3-thiazol-4-yl]-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| InChIKey | ATXYSICZQCPPAO-UHFFFAOYSA-N |
| SMILES | B(C1=C(SC=N1)C2=CC=C(C=C2)F)(O)OC(C)(C)C(C)(C)O |
Computed by PubChem (NCBI)