Products 2231344-26-4
CAS 2231344-26-4 is the registry number for (1H-Indol-3-yl)(2-isopropylthiazol-4-yl)methanone, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg.
1H-indol-3-yl-(2-propan-2-yl-1,3-thiazol-4-yl)methanone (CAS 2231344-26-4) is a chemical compound with the molecular formula C15H14N2OS and a molecular weight of 270.4 g/mol. IUPAC name: 1H-indol-3-yl-(2-propan-2-yl-1,3-thiazol-4-yl)methanone. InChIKey: CQBNGKXCXKZWTC-UHFFFAOYSA-N.
| Molecular formula | C15H14N2OS |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | 1H-indol-3-yl-(2-propan-2-yl-1,3-thiazol-4-yl)methanone |
| InChIKey | CQBNGKXCXKZWTC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=CS1)C(=O)C2=CNC3=CC=CC=C32 |
Computed by PubChem (NCBI)