CAS 2240-47-3 is the registry number for Triphenylphosphoranimine, 95%(NMR),RG, 95%(NMR),RG. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
Imino(triphenyl)-lambda5-phosphane (CAS 2240-47-3) is a chemical compound with the molecular formula C18H16NP and a molecular weight of 277.3 g/mol. IUPAC name: imino(triphenyl)-lambda5-phosphane. InChIKey: DHOUOTPZYIKUDF-UHFFFAOYSA-N.
| Molecular formula | C18H16NP |
|---|---|
| Molecular weight | 277.3 g/mol |
| IUPAC name | imino(triphenyl)-lambda5-phosphane |
| InChIKey | DHOUOTPZYIKUDF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(=N)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)