CAS 2241590-54-3 is the registry number for (S)-2-Methylazetidine (7,7-dimethyl-2-oxobicyclo(2.2.1)heptan-1-yl)methanesulfonate, 97+%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;(2S)-2-methylazetidine (CAS 2241590-54-3) is a chemical compound with the molecular formula C14H25NO4S and a molecular weight of 303.42 g/mol. IUPAC name: (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;(2S)-2-methylazetidine. InChIKey: KGZFOZKAGZDAAM-VWMHFEHESA-N.
| Molecular formula | C14H25NO4S |
|---|---|
| Molecular weight | 303.42 g/mol |
| IUPAC name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;(2S)-2-methylazetidine |
| InChIKey | KGZFOZKAGZDAAM-VWMHFEHESA-N |
| SMILES | C[C@H]1CCN1.CC1(C2CCC1(C(=O)C2)CS(=O)(=O)O)C |
Computed by PubChem (NCBI)