CAS 2243807-81-8 is the registry number for Roxadustat Impurity 54. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroxy-N-[2-(hydroxyamino)-2-oxoethyl]-1-methyl-7-phenoxyisoquinoline-3-carboxamide (CAS 2243807-81-8) is a chemical compound with the molecular formula C19H17N3O5 and a molecular weight of 367.4 g/mol. IUPAC name: 4-hydroxy-N-[2-(hydroxyamino)-2-oxoethyl]-1-methyl-7-phenoxyisoquinoline-3-carboxamide. InChIKey: AVZFZFSVDBUZJT-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O5 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 4-hydroxy-N-[2-(hydroxyamino)-2-oxoethyl]-1-methyl-7-phenoxyisoquinoline-3-carboxamide |
| InChIKey | AVZFZFSVDBUZJT-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C=CC2=C(C(=N1)C(=O)NCC(=O)NO)O)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)