CAS 2245080-10-6 is the registry number for 2-Chlorobenzo[1,2-b:4,3-b']bisbenzofuran, 99%, 99%. Offered by: Chemat. Available pack sizes: 25g, 100g, 250g.
5-chloro-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene (CAS 2245080-10-6) is a chemical compound with the molecular formula C18H9ClO2 and a molecular weight of 292.7 g/mol. IUPAC name: 5-chloro-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene. InChIKey: JEHVDEMTSQIKHF-UHFFFAOYSA-N.
| Molecular formula | C18H9ClO2 |
|---|---|
| Molecular weight | 292.7 g/mol |
| IUPAC name | 5-chloro-9,14-dioxapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3(8),4,6,11,15,17,19-nonaene |
| InChIKey | JEHVDEMTSQIKHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC4=C3C5=C(O4)C=CC(=C5)Cl |
Computed by PubChem (NCBI)