Products 2247451-32-5
CAS 2247451-32-5 is the registry number for Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-7-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-7-carboxylate (CAS 2247451-32-5) is a chemical compound with the molecular formula C15H19BN2O4 and a molecular weight of 302.14 g/mol. IUPAC name: methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-7-carboxylate. InChIKey: UNLVVCAEMYFMGS-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O4 |
|---|---|
| Molecular weight | 302.14 g/mol |
| IUPAC name | methyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole-7-carboxylate |
| InChIKey | UNLVVCAEMYFMGS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C(=C2)C(=O)OC)NN=C3 |
Computed by PubChem (NCBI)