Products 2252283-95-5
CAS 2252283-95-5 is the registry number for B-[3,5-Bis(1-methylethoxy)phenyl]boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
[3,5-di(propan-2-yloxy)phenyl]boronic acid (CAS 2252283-95-5) is a chemical compound with the molecular formula C12H19BO4 and a molecular weight of 238.09 g/mol. IUPAC name: [3,5-di(propan-2-yloxy)phenyl]boronic acid. InChIKey: VXRRPDCFBVMDNK-UHFFFAOYSA-N.
| Molecular formula | C12H19BO4 |
|---|---|
| Molecular weight | 238.09 g/mol |
| IUPAC name | [3,5-di(propan-2-yloxy)phenyl]boronic acid |
| InChIKey | VXRRPDCFBVMDNK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OC(C)C)OC(C)C)(O)O |
Computed by PubChem (NCBI)