CAS 2253632-36-7 is the registry number for 2-(4-Amino-1-[(tert-butoxy)carbonyl]piperidin-4-yl)acetic acid trifluoroacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
2-[4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid;2,2,2-trifluoroacetic acid (CAS 2253632-36-7) is a chemical compound with the molecular formula C14H23F3N2O6 and a molecular weight of 372.34 g/mol. IUPAC name: 2-[4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid;2,2,2-trifluoroacetic acid. InChIKey: FTCSVEKSPIMKDM-UHFFFAOYSA-N.
| Molecular formula | C14H23F3N2O6 |
|---|---|
| Molecular weight | 372.34 g/mol |
| IUPAC name | 2-[4-amino-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]acetic acid;2,2,2-trifluoroacetic acid |
| InChIKey | FTCSVEKSPIMKDM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(CC(=O)O)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)