CAS 2260550-44-3 is the registry number for tert-butyl cis-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]carbamate (CAS 2260550-44-3) is a chemical compound with the molecular formula C17H32BNO4 and a molecular weight of 325.3 g/mol. IUPAC name: tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]carbamate. InChIKey: ZWYIAEDQRNSROV-UHFFFAOYSA-N.
| Molecular formula | C17H32BNO4 |
|---|---|
| Molecular weight | 325.3 g/mol |
| IUPAC name | tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]carbamate |
| InChIKey | ZWYIAEDQRNSROV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCC(CC2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)