CAS 2270230-51-6 is the registry number for Hexadecanedioic Acid Acyl Glucuronide. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S,4S,5R,6S)-6-(15-carboxypentadecanoyloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 2270230-51-6) is a chemical compound with the molecular formula C22H38O10 and a molecular weight of 462.5 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-(15-carboxypentadecanoyloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: QLRJZDWHRKZABK-SXFAUFNYSA-N.
| Molecular formula | C22H38O10 |
|---|---|
| Molecular weight | 462.5 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-(15-carboxypentadecanoyloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | QLRJZDWHRKZABK-SXFAUFNYSA-N |
| SMILES | C(CCCCCCCC(=O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)O)O)O)O)CCCCCCC(=O)O |
Computed by PubChem (NCBI)