Products 2271327-59-2
CAS 2271327-59-2 is the registry number for (1R)-2,2',3,3'-Tetrahydro-3,3,3',3'-tetramethyl-1,1'-spirobi[1H-indene]-7,7'-dicarboxylic acid 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-4,4'-dicarboxylic acid (CAS 2271327-59-2) is a chemical compound with the molecular formula C23H24O4 and a molecular weight of 364.4 g/mol. IUPAC name: 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-4,4'-dicarboxylic acid. InChIKey: YFMUXAYHYBJTPK-UHFFFAOYSA-N.
| Molecular formula | C23H24O4 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-4,4'-dicarboxylic acid |
| InChIKey | YFMUXAYHYBJTPK-UHFFFAOYSA-N |
| SMILES | CC1(CC2(CC(C3=CC=CC(=C32)C(=O)O)(C)C)C4=C(C=CC=C41)C(=O)O)C |
Computed by PubChem (NCBI)