Products 2298385-66-5

CAS 2298385-66-5 is the registry number for Methyl 3,3-difluoro-1-hydroxycyclobutanecarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3,3-difluoro-1-hydroxycyclobutane-1-carboxylate (CAS 2298385-66-5) is a chemical compound with the molecular formula C6H8F2O3 and a molecular weight of 166.12 g/mol. IUPAC name: methyl 3,3-difluoro-1-hydroxycyclobutane-1-carboxylate. InChIKey: YVCBYKCMVYTWSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8F2O3
Molecular weight166.12 g/mol
IUPAC namemethyl 3,3-difluoro-1-hydroxycyclobutane-1-carboxylate
InChIKeyYVCBYKCMVYTWSZ-UHFFFAOYSA-N
SMILESCOC(=O)C1(CC(C1)(F)F)O

Computed by PubChem (NCBI)