CAS 2304633-91-6 is the registry number for (2-Chloro-4-(2,2,2-trifluoroethoxy)phenyl)boronic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid (CAS 2304633-91-6) is a chemical compound with the molecular formula C8H7BClF3O3 and a molecular weight of 254.40 g/mol. IUPAC name: [2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid. InChIKey: NZCFZJBSJZLAOV-UHFFFAOYSA-N.
| Molecular formula | C8H7BClF3O3 |
|---|---|
| Molecular weight | 254.40 g/mol |
| IUPAC name | [2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
| InChIKey | NZCFZJBSJZLAOV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCC(F)(F)F)Cl)(O)O |
Computed by PubChem (NCBI)