CAS 2304634-81-7 is the registry number for 3-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)-3-oxetanecarboxylic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 50mg.
Ethyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxetane-3-carboxylate (CAS 2304634-81-7) is a chemical compound with the molecular formula C18H25BO5 and a molecular weight of 332.2 g/mol. IUPAC name: ethyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxetane-3-carboxylate. InChIKey: ITEJVWGBLWSDJQ-UHFFFAOYSA-N.
| Molecular formula | C18H25BO5 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | ethyl 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxetane-3-carboxylate |
| InChIKey | ITEJVWGBLWSDJQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3(COC3)C(=O)OCC |
Computed by PubChem (NCBI)