CAS 2305253-70-5 is the registry number for 2-Amino-3-(2-amino-4-chloro-6-oxo-1,6-dihydropyrimidin-5-yl)propanoic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-3-(2-amino-4-chloro-6-oxo-1H-pyrimidin-5-yl)propanoic acid;dihydrochloride (CAS 2305253-70-5) is a chemical compound with the molecular formula C7H11Cl3N4O3 and a molecular weight of 305.5 g/mol. IUPAC name: 2-amino-3-(2-amino-4-chloro-6-oxo-1H-pyrimidin-5-yl)propanoic acid;dihydrochloride. InChIKey: ONINHTMMBWDJOX-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl3N4O3 |
|---|---|
| Molecular weight | 305.5 g/mol |
| IUPAC name | 2-amino-3-(2-amino-4-chloro-6-oxo-1H-pyrimidin-5-yl)propanoic acid;dihydrochloride |
| InChIKey | ONINHTMMBWDJOX-UHFFFAOYSA-N |
| SMILES | C(C1=C(N=C(NC1=O)N)Cl)C(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)