CAS 2305899-76-5 appears in our catalog under these names: 2'-Chloro-[1,1':3',1''-terphenyl]-4,4'',5'-tricarboxylic acid, 98%, 2'-Chloro-[1,1':3',1''-terphenyl]-4,4'',5'-tricarboxylic acid, 95%, 95%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
3,5-bis(4-carboxyphenyl)-4-chlorobenzoic acid (CAS 2305899-76-5) is a chemical compound with the molecular formula C21H13ClO6 and a molecular weight of 396.8 g/mol. IUPAC name: 3,5-bis(4-carboxyphenyl)-4-chlorobenzoic acid. InChIKey: GLRXNHLOWYXTMR-UHFFFAOYSA-N.
| Molecular formula | C21H13ClO6 |
|---|---|
| Molecular weight | 396.8 g/mol |
| IUPAC name | 3,5-bis(4-carboxyphenyl)-4-chlorobenzoic acid |
| InChIKey | GLRXNHLOWYXTMR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=CC(=C2Cl)C3=CC=C(C=C3)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)