CAS 2306264-07-1 is the registry number for 4-Amino-5-(3-fluoro-4-nitrophenyl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-5-(3-fluoro-4-nitrophenyl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid (CAS 2306264-07-1) is a chemical compound with the molecular formula C13H8FN5O4 and a molecular weight of 317.23 g/mol. IUPAC name: 4-amino-5-(3-fluoro-4-nitrophenyl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid. InChIKey: YRALOLDQCOBCJT-UHFFFAOYSA-N.
| Molecular formula | C13H8FN5O4 |
|---|---|
| Molecular weight | 317.23 g/mol |
| IUPAC name | 4-amino-5-(3-fluoro-4-nitrophenyl)pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid |
| InChIKey | YRALOLDQCOBCJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C3C(=NC=NN3C=C2C(=O)O)N)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)