CAS 2306268-83-5 is the registry number for 4-((6-Methyl-2,6-diazaspiro[3.3]heptan-2-yl)methyl)-3-(trifluoromethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)methyl]-3-(trifluoromethyl)benzoic acid (CAS 2306268-83-5) is a chemical compound with the molecular formula C15H17F3N2O2 and a molecular weight of 314.30 g/mol. IUPAC name: 4-[(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)methyl]-3-(trifluoromethyl)benzoic acid. InChIKey: YFSKCNVTSLFJOE-UHFFFAOYSA-N.
| Molecular formula | C15H17F3N2O2 |
|---|---|
| Molecular weight | 314.30 g/mol |
| IUPAC name | 4-[(6-methyl-2,6-diazaspiro[3.3]heptan-2-yl)methyl]-3-(trifluoromethyl)benzoic acid |
| InChIKey | YFSKCNVTSLFJOE-UHFFFAOYSA-N |
| SMILES | CN1CC2(C1)CN(C2)CC3=C(C=C(C=C3)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)