CAS 2308530-30-3 is the registry number for 3,3''-Bis(trifluoromethyl)-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-[4-carboxy-3-(trifluoromethyl)phenyl]phenyl]-2-(trifluoromethyl)benzoic acid (CAS 2308530-30-3) is a chemical compound with the molecular formula C22H12F6O4 and a molecular weight of 454.3 g/mol. IUPAC name: 4-[4-[4-carboxy-3-(trifluoromethyl)phenyl]phenyl]-2-(trifluoromethyl)benzoic acid. InChIKey: ZOWVVXDBDAYIKE-UHFFFAOYSA-N.
| Molecular formula | C22H12F6O4 |
|---|---|
| Molecular weight | 454.3 g/mol |
| IUPAC name | 4-[4-[4-carboxy-3-(trifluoromethyl)phenyl]phenyl]-2-(trifluoromethyl)benzoic acid |
| InChIKey | ZOWVVXDBDAYIKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)C(=O)O)C(F)(F)F)C3=CC(=C(C=C3)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)