CAS 2315283-97-5 appears in our catalog under these names: 8-Bromo-6-fluoroimidazo[1,2-a]pyridine hydrochloride, 98%, 98%, 8-Bromo-6-fluoroimidazo[1,2-a]pyridine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
8-bromo-6-fluoroimidazo[1,2-a]pyridine;hydrochloride (CAS 2315283-97-5) is a chemical compound with the molecular formula C7H5BrClFN2 and a molecular weight of 251.48 g/mol. IUPAC name: 8-bromo-6-fluoroimidazo[1,2-a]pyridine;hydrochloride. InChIKey: SCSMXHIYKBBBLK-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClFN2 |
|---|---|
| Molecular weight | 251.48 g/mol |
| IUPAC name | 8-bromo-6-fluoroimidazo[1,2-a]pyridine;hydrochloride |
| InChIKey | SCSMXHIYKBBBLK-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)Br)F.Cl |
Computed by PubChem (NCBI)