CAS 2317-66-0 is the registry number for 4,4,5,5,5-Pentafluoro-1-furan-2-yl-pentane-1,3-dione, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
4,4,5,5,5-pentafluoro-1-(furan-2-yl)pentane-1,3-dione (CAS 2317-66-0) is a chemical compound with the molecular formula C9H5F5O3 and a molecular weight of 256.13 g/mol. IUPAC name: 4,4,5,5,5-pentafluoro-1-(furan-2-yl)pentane-1,3-dione. InChIKey: FBFKOUOYDDHGMJ-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O3 |
|---|---|
| Molecular weight | 256.13 g/mol |
| IUPAC name | 4,4,5,5,5-pentafluoro-1-(furan-2-yl)pentane-1,3-dione |
| InChIKey | FBFKOUOYDDHGMJ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)CC(=O)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)