CAS 2339904-91-3 is the registry number for Lumateperone Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
(10S,15R)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (CAS 2339904-91-3) is a chemical compound with the molecular formula C14H19N3 and a molecular weight of 229.32 g/mol. IUPAC name: (10S,15R)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene. InChIKey: QLGUCSLWLPCOTR-VXGBXAGGSA-N.
| Molecular formula | C14H19N3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | (10S,15R)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| InChIKey | QLGUCSLWLPCOTR-VXGBXAGGSA-N |
| SMILES | CN1CCN2[C@@H]3CCNC[C@@H]3C4=C2C1=CC=C4 |
Computed by PubChem (NCBI)