CAS 2341796-81-2 appears in our catalog under these names: GSK143 dihydrochloride, GSK143 (dihydrochloride), 99.73%, 99.73%, GSK143 (dihydrochloride), 99.37%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 10mM/1mL, 25 mg, 50 mg.
2-[[(3R,4R)-3-aminooxan-4-yl]amino]-4-(4-methylanilino)pyrimidine-5-carboxamide;dihydrochloride (CAS 2341796-81-2) is a chemical compound with the molecular formula C17H24Cl2N6O2 and a molecular weight of 415.3 g/mol. IUPAC name: 2-[[(3R,4R)-3-aminooxan-4-yl]amino]-4-(4-methylanilino)pyrimidine-5-carboxamide;dihydrochloride. InChIKey: UEHPBSLIDBDMCZ-WICJZZOFSA-N.
| Molecular formula | C17H24Cl2N6O2 |
|---|---|
| Molecular weight | 415.3 g/mol |
| IUPAC name | 2-[[(3R,4R)-3-aminooxan-4-yl]amino]-4-(4-methylanilino)pyrimidine-5-carboxamide;dihydrochloride |
| InChIKey | UEHPBSLIDBDMCZ-WICJZZOFSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=NC(=NC=C2C(=O)N)N[C@@H]3CCOC[C@@H]3N.Cl.Cl |
Computed by PubChem (NCBI)