Products 2342574-90-5
CAS 2342574-90-5 is the registry number for 18:1-21:2-18:1 TG-d5, 99.00%. Offered by: MedChemExpress. Available pack sizes: 1 mg (1.07 mM * 1 mL in DCM:Methanol (1:1)).
[1,1,2,3,3-pentadeuterio-1,3-bis[[(E)-octadec-9-enoyl]oxy]propan-2-yl] (12E,15E)-henicosa-12,15-dienoate (CAS 2342574-90-5) is a chemical compound with the molecular formula C60H108O6 and a molecular weight of 930.5 g/mol. IUPAC name: [1,1,2,3,3-pentadeuterio-1,3-bis[[(E)-octadec-9-enoyl]oxy]propan-2-yl] (12E,15E)-henicosa-12,15-dienoate. InChIKey: ZGWKVAYMDCDYQO-MRHISVQTSA-N.
| Molecular formula | C60H108O6 |
|---|---|
| Molecular weight | 930.5 g/mol |
| IUPAC name | [1,1,2,3,3-pentadeuterio-1,3-bis[[(E)-octadec-9-enoyl]oxy]propan-2-yl] (12E,15E)-henicosa-12,15-dienoate |
| InChIKey | ZGWKVAYMDCDYQO-MRHISVQTSA-N |
| SMILES | [2H]C(OC(=O)CCCCCCC/C=C/CCCCCCCC)(C(OC(=O)CCCCCCCCCC/C=C/C/C=C/CCCCC)(C(OC(=O)CCCCCCC/C=C/CCCCCCCC)([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)