Products 2342574-91-6
CAS 2342574-91-6 is the registry number for 18:1-17:1-18:1 TG-d5, 99.00%. Offered by: MedChemExpress. Available pack sizes: 1 mg (1.14 mM * 1 mL in DCM:Methanol (1:1)).
[1,1,2,3,3-pentadeuterio-2-[(E)-heptadec-10-enoyl]oxy-3-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate (CAS 2342574-91-6) is a chemical compound with the molecular formula C56H102O6 and a molecular weight of 876.4 g/mol. IUPAC name: [1,1,2,3,3-pentadeuterio-2-[(E)-heptadec-10-enoyl]oxy-3-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate. InChIKey: MOYCRTIGLGCJHW-UOALETSBSA-N.
| Molecular formula | C56H102O6 |
|---|---|
| Molecular weight | 876.4 g/mol |
| IUPAC name | [1,1,2,3,3-pentadeuterio-2-[(E)-heptadec-10-enoyl]oxy-3-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoate |
| InChIKey | MOYCRTIGLGCJHW-UOALETSBSA-N |
| SMILES | [2H]C(OC(=O)CCCCCCC/C=C/CCCCCCCC)(C(OC(=O)CCCCCCCC/C=C/CCCCCC)(C(OC(=O)CCCCCCC/C=C/CCCCCCCC)([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)