CAS 2351801-41-5 is the registry number for CHMFL-KIT-033, 99.74%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 100 mg, 50 mg, 10mM/1mL, 5 mg, 10 mg.
N-(3-fluorophenyl)-N'-[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]propanediamide (CAS 2351801-41-5) is a chemical compound with the molecular formula C23H18FN5O2 and a molecular weight of 415.4 g/mol. IUPAC name: N-(3-fluorophenyl)-N'-[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]propanediamide. InChIKey: OLZDZYHEIBZXCI-CSKARUKUSA-N.
| Molecular formula | C23H18FN5O2 |
|---|---|
| Molecular weight | 415.4 g/mol |
| IUPAC name | N-(3-fluorophenyl)-N'-[3-[(E)-2-pyridin-2-ylethenyl]-1H-indazol-6-yl]propanediamide |
| InChIKey | OLZDZYHEIBZXCI-CSKARUKUSA-N |
| SMILES | C1=CC=NC(=C1)/C=C/C2=NNC3=C2C=CC(=C3)NC(=O)CC(=O)NC4=CC(=CC=C4)F |
Computed by PubChem (NCBI)