Products 2363129-95-5
CAS 2363129-95-5 is the registry number for tert-Butyl 4-amino-2-hydroxybenzoate, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
(2S)-2-amino-3-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]propanoic acid;hydrochloride (CAS 2363129-95-5) is a chemical compound with the molecular formula C12H14ClN5O2 and a molecular weight of 295.72 g/mol. IUPAC name: (2S)-2-amino-3-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]propanoic acid;hydrochloride. InChIKey: ZLBQZHGWCSAZQJ-PPHPATTJSA-N.
| Molecular formula | C12H14ClN5O2 |
|---|---|
| Molecular weight | 295.72 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]propanoic acid;hydrochloride |
| InChIKey | ZLBQZHGWCSAZQJ-PPHPATTJSA-N |
| SMILES | CC1=NN=C(N=N1)C2=CC=C(C=C2)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)