Products 2364365-13-7

CAS 2364365-13-7 is the registry number for 2',5'-Difluoro-[1,1':4',1''-terphenyl]-2,2'',5,5''-tetracarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[4-(2,5-dicarboxyphenyl)-2,5-difluorophenyl]terephthalic acid (CAS 2364365-13-7) is a chemical compound with the molecular formula C22H12F2O8 and a molecular weight of 442.3 g/mol. IUPAC name: 2-[4-(2,5-dicarboxyphenyl)-2,5-difluorophenyl]terephthalic acid. InChIKey: FHQAHSDEEFQHPG-UHFFFAOYSA-N.

Identity
Molecular formulaC22H12F2O8
Molecular weight442.3 g/mol
IUPAC name2-[4-(2,5-dicarboxyphenyl)-2,5-difluorophenyl]terephthalic acid
InChIKeyFHQAHSDEEFQHPG-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)C2=CC(=C(C=C2F)C3=C(C=CC(=C3)C(=O)O)C(=O)O)F)C(=O)O

Computed by PubChem (NCBI)