CAS 2365277-37-6 is the registry number for Rel-tert-butyl (4aS,7aR)-3-oxohexahydropyrrolo[3,4-b][1,4]oxazine-6(2H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4aR,7aS)-3-oxo-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate (CAS 2365277-37-6) is a chemical compound with the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. IUPAC name: tert-butyl (4aR,7aS)-3-oxo-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate. InChIKey: YDGKPNUYHUQQDS-SFYZADRCSA-N.
| Molecular formula | C11H18N2O4 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | tert-butyl (4aR,7aS)-3-oxo-4a,5,7,7a-tetrahydro-4H-pyrrolo[3,4-b][1,4]oxazine-6-carboxylate |
| InChIKey | YDGKPNUYHUQQDS-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@H](C1)OCC(=O)N2 |
Computed by PubChem (NCBI)